C13H6F13NO2 — CID 4292897
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(2-hydroxyphenyl)heptanamide (PubChem CID 4292897) has the molecular formula C13H6F13NO2 and a molecular weight of 455.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(2-hydroxyphenyl)heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(2-hydroxyphenyl)heptanamide |
|---|---|
| PubChem CID | 4292897 |
| Molecular Formula | C13H6F13NO2 |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-N-(2-hydroxyphenyl)heptanamide |
| SMILES | O=C(Nc1ccccc1O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H6F13NO2/c14-8(15,7(29)27-5-3-1-2-4-6(5)28)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1-4,28H,(H,27,29) |
| InChIKey | NZIMAQXLUOZFJJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|