C16H10F13NO3 — CID 5086660
ethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)benzoate (PubChem CID 5086660) has the molecular formula C16H10F13NO3 and a molecular weight of 511.23 g/mol. Its IUPAC name is ethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)benzoate.
| Compound Name | ethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)benzoate |
|---|---|
| PubChem CID | 5086660 |
| Molecular Formula | C16H10F13NO3 |
| Molecular Weight | 511.23 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | ethyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoylamino)benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F13NO3/c1-2-33-9(31)7-5-3-4-6-8(7)30-10(32)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h3-6H,2H2,1H3,(H,30,32) |
| InChIKey | CJBRMOHJHJKIJB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|