C13H6F13NO3 — CID 118215209
N-(2,5-dihydroxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 118215209) has the molecular formula C13H6F13NO3 and a molecular weight of 471.17 g/mol. Its IUPAC name is N-(2,5-dihydroxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-(2,5-dihydroxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 118215209 |
| Molecular Formula | C13H6F13NO3 |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | N-(2,5-dihydroxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | O=C(Nc1cc(O)ccc1O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H6F13NO3/c14-8(15,7(30)27-5-3-4(28)1-2-6(5)29)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1-3,28-29H,(H,27,30) |
| InChIKey | LRKYYCJWKFOXEJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|