C14H7ClF13NO2 — CID 4165348
N-(5-chloro-2-methoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 4165348) has the molecular formula C14H7ClF13NO2 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 4165348 |
| Molecular Formula | C14H7ClF13NO2 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H7ClF13NO2/c1-31-7-3-2-5(15)4-6(7)29-8(30)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28/h2-4H,1H3,(H,29,30) |
| InChIKey | FODBPCMCPHNIFS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|