C17H21ClF3N3O5 — CID 28841007
methyl (2S)-2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-2-(2,2-dimethylpropanoylamino)-3,3,3-trifluoropropanoate (PubChem CID 28841007) has the molecular formula C17H21ClF3N3O5 and a molecular weight of 439.82 g/mol. Its IUPAC name is methyl (2S)-2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-2-(2,2-dimethylpropanoylamino)-3,3,3-trifluoropropanoate.
| Compound Name | methyl (2S)-2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-2-(2,2-dimethylpropanoylamino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 28841007 |
| Molecular Formula | C17H21ClF3N3O5 |
| Molecular Weight | 439.82 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | methyl (2S)-2-[(5-chloro-2-methoxyphenyl)carbamoylamino]-2-(2,2-dimethylpropanoylamino)-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@@](NC(=O)Nc1cc(Cl)ccc1OC)(NC(=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C17H21ClF3N3O5/c1-15(2,3)12(25)23-16(13(26)29-5,17(19,20)21)24-14(27)22-10-8-9(18)6-7-11(10)28-4/h6-8H,1-5H3,(H,23,25)(H2,22,24,27)/t16-/m0/s1 |
| InChIKey | UANVVRWVOMDEAJ-INIZCTEOSA-N |
| XLogP | 3.06 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|