C17H19ClN2O2 — CID 108875486
1-(5-chloro-2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)urea (PubChem CID 108875486) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 108875486 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H19ClN2O2/c1-10-7-11(2)16(12(3)8-10)20-17(21)19-14-9-13(18)5-6-15(14)22-4/h5-9H,1-4H3,(H2,19,20,21) |
| InChIKey | TXBFKPIWZZRROG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |