C17H16Cl2N2O5 — CID 108502302
N-(4-chloro-2,5-dimethoxyphenyl)-N'-(5-chloro-2-methoxyphenyl)oxamide (PubChem CID 108502302) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-N'-(5-chloro-2-methoxyphenyl)oxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-(5-chloro-2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108502302 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-(5-chloro-2-methoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cc(Cl)ccc2OC)c(OC)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-24-13-5-4-9(18)6-11(13)20-16(22)17(23)21-12-8-14(25-2)10(19)7-15(12)26-3/h4-8H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | OGBGHVNCYQWIAE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|