C14H19ClN2O4 — CID 108506924
N'-tert-butyl-N-(4-chloro-2,5-dimethoxyphenyl)oxamide (PubChem CID 108506924) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is N'-tert-butyl-N-(4-chloro-2,5-dimethoxyphenyl)oxamide.
| Compound Name | N'-tert-butyl-N-(4-chloro-2,5-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108506924 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N'-tert-butyl-N-(4-chloro-2,5-dimethoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)C)c(OC)cc1Cl |
| InChI | InChI=1S/C14H19ClN2O4/c1-14(2,3)17-13(19)12(18)16-9-7-10(20-4)8(15)6-11(9)21-5/h6-7H,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | LZYPHUDLHPPBCZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|