C18H27ClN2O4 — CID 108526291
N-(4-chloro-2,5-dimethoxyphenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide (PubChem CID 108526291) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
|---|---|
| PubChem CID | 108526291 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-N'-(2,4,4-trimethylpentan-2-yl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CC(C)(C)C)c(OC)cc1Cl |
| InChI | InChI=1S/C18H27ClN2O4/c1-17(2,3)10-18(4,5)21-16(23)15(22)20-12-9-13(24-6)11(19)8-14(12)25-7/h8-9H,10H2,1-7H3,(H,20,22)(H,21,23) |
| InChIKey | NJIGUXATLPHCHO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|