C16H25ClN2O2 — CID 10245038
1-(3-chloro-4-methoxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 10245038) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 10245038 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | COc1ccc(NC(=O)NC(C)(C)CC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C16H25ClN2O2/c1-15(2,3)10-16(4,5)19-14(20)18-11-7-8-13(21-6)12(17)9-11/h7-9H,10H2,1-6H3,(H2,18,19,20) |
| InChIKey | PMXDDMRSVNKZTM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |