C15H22ClN3O3 — CID 74235615
4-[(3-chloro-4-methoxyphenyl)carbamoylamino]-N,4-dimethylpentanamide (PubChem CID 74235615) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]-N,4-dimethylpentanamide.
| Compound Name | 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 74235615 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-[(3-chloro-4-methoxyphenyl)carbamoylamino]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)CCC(C)(C)NC(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-15(2,8-7-13(20)17-3)19-14(21)18-10-5-6-12(22-4)11(16)9-10/h5-6,9H,7-8H2,1-4H3,(H,17,20)(H2,18,19,21) |
| InChIKey | ABWNYSYJOWIZBP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |