C16H25N3O2S — CID 118770134
4-[(4-ethylsulfanylphenyl)carbamoylamino]-N,4-dimethylpentanamide (PubChem CID 118770134) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-[(4-ethylsulfanylphenyl)carbamoylamino]-N,4-dimethylpentanamide.
| Compound Name | 4-[(4-ethylsulfanylphenyl)carbamoylamino]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 118770134 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[(4-ethylsulfanylphenyl)carbamoylamino]-N,4-dimethylpentanamide |
| SMILES | CCSc1ccc(NC(=O)NC(C)(C)CCC(=O)NC)cc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-5-22-13-8-6-12(7-9-13)18-15(21)19-16(2,3)11-10-14(20)17-4/h6-9H,5,10-11H2,1-4H3,(H,17,20)(H2,18,19,21) |
| InChIKey | BJCRQEXBDRLCLA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |