C21H25NO3S — CID 145231777
methyl 2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]-2-methylpropanoate (PubChem CID 145231777) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is methyl 2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]-2-methylpropanoate.
| Compound Name | methyl 2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 145231777 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl 2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]-2-methylpropanoate |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C21H25NO3S/c1-5-26-18-12-6-15(7-13-18)14-19(23)22-17-10-8-16(9-11-17)21(2,3)20(24)25-4/h6-13H,5,14H2,1-4H3,(H,22,23) |
| InChIKey | MTQVUNWTLYSUTI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |