C25H28F2N2O2S — CID 145231935
N-[4-(1,1-difluoro-2-oxoethyl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide;(3E)-N-methylhexa-1,3,5-trien-3-amine (PubChem CID 145231935) has the molecular formula C25H28F2N2O2S and a molecular weight of 458.57 g/mol. Its IUPAC name is N-[4-(1,1-difluoro-2-oxoethyl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide;(3E)-N-methylhexa-1,3,5-trien-3-amine.
| Compound Name | N-[4-(1,1-difluoro-2-oxoethyl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide;(3E)-N-methylhexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145231935 |
| Molecular Formula | C25H28F2N2O2S |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[4-(1,1-difluoro-2-oxoethyl)phenyl]-2-(4-ethylsulfanylphenyl)acetamide;(3E)-N-methylhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(\C=C)NC.CCSc1ccc(CC(=O)Nc2ccc(C(F)(F)C=O)cc2)cc1 |
| InChI | InChI=1S/C18H17F2NO2S.C7H11N/c1-2-24-16-9-3-13(4-10-16)11-17(23)21-15-7-5-14(6-8-15)18(19,20)12-22;1-4-6-7(5-2)8-3/h3-10,12H,2,11H2,1H3,(H,21,23);4-6,8H,1-2H2,3H3/b;7-6+ |
| InChIKey | CYSIPLACEAXLFL-UETGHTDLSA-N |
| XLogP | 5.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|