C22H19F3N2OS — CID 144539996
2-(4-ethylsulfanylphenyl)-N-[4-pyridin-3-yl-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 144539996) has the molecular formula C22H19F3N2OS and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-N-[4-pyridin-3-yl-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfanylphenyl)-N-[4-pyridin-3-yl-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 144539996 |
| Molecular Formula | C22H19F3N2OS |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-N-[4-pyridin-3-yl-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(-c3cccnc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H19F3N2OS/c1-2-29-18-8-5-15(6-9-18)12-21(28)27-17-7-10-19(16-4-3-11-26-14-16)20(13-17)22(23,24)25/h3-11,13-14H,2,12H2,1H3,(H,27,28) |
| InChIKey | SHIFBYMCSAIAOI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |