C28H24FNO2S — CID 123858744
2-(4-ethylsulfanylphenyl)-N-[4-(3-fluorophenyl)-3-phenoxyphenyl]acetamide (PubChem CID 123858744) has the molecular formula C28H24FNO2S and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-N-[4-(3-fluorophenyl)-3-phenoxyphenyl]acetamide.
| Compound Name | 2-(4-ethylsulfanylphenyl)-N-[4-(3-fluorophenyl)-3-phenoxyphenyl]acetamide |
|---|---|
| PubChem CID | 123858744 |
| Molecular Formula | C28H24FNO2S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-N-[4-(3-fluorophenyl)-3-phenoxyphenyl]acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(-c3cccc(F)c3)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H24FNO2S/c1-2-33-25-14-11-20(12-15-25)17-28(31)30-23-13-16-26(21-7-6-8-22(29)18-21)27(19-23)32-24-9-4-3-5-10-24/h3-16,18-19H,2,17H2,1H3,(H,30,31) |
| InChIKey | POCCLYPQGAAPOX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |