C28H23F2NO4S — CID 72548784
2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-(3-fluorophenyl)phenyl]acetamide (PubChem CID 72548784) has the molecular formula C28H23F2NO4S and a molecular weight of 507.56 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-(3-fluorophenyl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-(3-fluorophenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 72548784 |
| Molecular Formula | C28H23F2NO4S |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[3-(3-fluorophenoxy)-4-(3-fluorophenyl)phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3cccc(F)c3)c(Oc3cccc(F)c3)c2)cc1 |
| InChI | InChI=1S/C28H23F2NO4S/c1-2-36(33,34)25-12-9-19(10-13-25)15-28(32)31-23-11-14-26(20-5-3-6-21(29)16-20)27(18-23)35-24-8-4-7-22(30)17-24/h3-14,16-18H,2,15H2,1H3,(H,31,32) |
| InChIKey | BHKNBXXGNBWTMT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |