C28H22F4N2O4S — CID 72548310
2-(4-ethylsulfonylphenyl)-N-[4-(2-fluoro-4-pyridinyl)-3-[3-(trifluoromethyl)phenoxy]phenyl]acetamide (PubChem CID 72548310) has the molecular formula C28H22F4N2O4S and a molecular weight of 558.55 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-(2-fluoro-4-pyridinyl)-3-[3-(trifluoromethyl)phenoxy]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-(2-fluoro-4-pyridinyl)-3-[3-(trifluoromethyl)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 72548310 |
| Molecular Formula | C28H22F4N2O4S |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-(2-fluoro-4-pyridinyl)-3-[3-(trifluoromethyl)phenoxy]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3ccnc(F)c3)c(Oc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C28H22F4N2O4S/c1-2-39(36,37)23-9-6-18(7-10-23)14-27(35)34-21-8-11-24(19-12-13-33-26(29)15-19)25(17-21)38-22-5-3-4-20(16-22)28(30,31)32/h3-13,15-17H,2,14H2,1H3,(H,34,35) |
| InChIKey | ZSCGDHJZKCMPRP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|