C28H24ClNO4S — CID 72545950
N-[4-(3-chlorophenyl)-3-phenoxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 72545950) has the molecular formula C28H24ClNO4S and a molecular weight of 506.02 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-3-phenoxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[4-(3-chlorophenyl)-3-phenoxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 72545950 |
| Molecular Formula | C28H24ClNO4S |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | N-[4-(3-chlorophenyl)-3-phenoxyphenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3cccc(Cl)c3)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H24ClNO4S/c1-2-35(32,33)25-14-11-20(12-15-25)17-28(31)30-23-13-16-26(21-7-6-8-22(29)18-21)27(19-23)34-24-9-4-3-5-10-24/h3-16,18-19H,2,17H2,1H3,(H,30,31) |
| InChIKey | KHRUFIYJUFJEGV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |