C29H23ClN2O2S — CID 123794161
N-[4-(3-chlorophenyl)-3-(2-cyanophenoxy)phenyl]-2-(4-ethylsulfanylphenyl)acetamide (PubChem CID 123794161) has the molecular formula C29H23ClN2O2S and a molecular weight of 499.04 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-3-(2-cyanophenoxy)phenyl]-2-(4-ethylsulfanylphenyl)acetamide.
| Compound Name | N-[4-(3-chlorophenyl)-3-(2-cyanophenoxy)phenyl]-2-(4-ethylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 123794161 |
| Molecular Formula | C29H23ClN2O2S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-[4-(3-chlorophenyl)-3-(2-cyanophenoxy)phenyl]-2-(4-ethylsulfanylphenyl)acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(-c3cccc(Cl)c3)c(Oc3ccccc3C#N)c2)cc1 |
| InChI | InChI=1S/C29H23ClN2O2S/c1-2-35-25-13-10-20(11-14-25)16-29(33)32-24-12-15-26(21-7-5-8-23(30)17-21)28(18-24)34-27-9-4-3-6-22(27)19-31/h3-15,17-18H,2,16H2,1H3,(H,32,33) |
| InChIKey | UFQYQTWTPOEXNU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |