C28H22F4N2O3S — CID 123638254
2-(4-ethylsulfanylphenyl)-N-[4-(6-fluoro-3-pyridinyl)-3-[3-(trifluoromethoxy)phenoxy]phenyl]acetamide (PubChem CID 123638254) has the molecular formula C28H22F4N2O3S and a molecular weight of 542.55 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-N-[4-(6-fluoro-3-pyridinyl)-3-[3-(trifluoromethoxy)phenoxy]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfanylphenyl)-N-[4-(6-fluoro-3-pyridinyl)-3-[3-(trifluoromethoxy)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 123638254 |
| Molecular Formula | C28H22F4N2O3S |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-N-[4-(6-fluoro-3-pyridinyl)-3-[3-(trifluoromethoxy)phenoxy]phenyl]acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(-c3ccc(F)nc3)c(Oc3cccc(OC(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C28H22F4N2O3S/c1-2-38-23-10-6-18(7-11-23)14-27(35)34-20-9-12-24(19-8-13-26(29)33-17-19)25(15-20)36-21-4-3-5-22(16-21)37-28(30,31)32/h3-13,15-17H,2,14H2,1H3,(H,34,35) |
| InChIKey | RTOYKVBSGWRYEU-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|