C27H22F2N2O2S — CID 123900194
2-(4-ethylsulfanylphenyl)-N-[3-(3-fluorophenoxy)-4-(2-fluoro-4-pyridinyl)phenyl]acetamide (PubChem CID 123900194) has the molecular formula C27H22F2N2O2S and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-N-[3-(3-fluorophenoxy)-4-(2-fluoro-4-pyridinyl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfanylphenyl)-N-[3-(3-fluorophenoxy)-4-(2-fluoro-4-pyridinyl)phenyl]acetamide |
|---|---|
| PubChem CID | 123900194 |
| Molecular Formula | C27H22F2N2O2S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-N-[3-(3-fluorophenoxy)-4-(2-fluoro-4-pyridinyl)phenyl]acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(-c3ccnc(F)c3)c(Oc3cccc(F)c3)c2)cc1 |
| InChI | InChI=1S/C27H22F2N2O2S/c1-2-34-23-9-6-18(7-10-23)14-27(32)31-21-8-11-24(19-12-13-30-26(29)15-19)25(17-21)33-22-5-3-4-20(28)16-22/h3-13,15-17H,2,14H2,1H3,(H,31,32) |
| InChIKey | YCUWZCFDIGLAEP-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|