C28H23ClFNO4S — CID 72544310
N-[4-(3-chlorophenyl)-3-(2-fluorophenoxy)phenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 72544310) has the molecular formula C28H23ClFNO4S and a molecular weight of 524.01 g/mol. Its IUPAC name is N-[4-(3-chlorophenyl)-3-(2-fluorophenoxy)phenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[4-(3-chlorophenyl)-3-(2-fluorophenoxy)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 72544310 |
| Molecular Formula | C28H23ClFNO4S |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | N-[4-(3-chlorophenyl)-3-(2-fluorophenoxy)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3cccc(Cl)c3)c(Oc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C28H23ClFNO4S/c1-2-36(33,34)23-13-10-19(11-14-23)16-28(32)31-22-12-15-24(20-6-5-7-21(29)17-20)27(18-22)35-26-9-4-3-8-25(26)30/h3-15,17-18H,2,16H2,1H3,(H,31,32) |
| InChIKey | GBOXQDXFAYYGTR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |