C23H19F4NO4S — CID 71283853
2-(4-ethylsulfonylphenyl)-N-[2-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]acetamide (PubChem CID 71283853) has the molecular formula C23H19F4NO4S and a molecular weight of 481.47 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[2-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[2-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71283853 |
| Molecular Formula | C23H19F4NO4S |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[2-fluoro-4-[2-(trifluoromethoxy)phenyl]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3ccccc3OC(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C23H19F4NO4S/c1-2-33(30,31)17-10-7-15(8-11-17)13-22(29)28-20-12-9-16(14-19(20)24)18-5-3-4-6-21(18)32-23(25,26)27/h3-12,14H,2,13H2,1H3,(H,28,29) |
| InChIKey | GKLFIWSNPZVZLC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |