C25H21F3N2O4S — CID 71285804
2-(4-ethylsulfonylphenyl)-N-[4-[2-(trifluoromethoxy)phenyl]-1H-indol-7-yl]acetamide (PubChem CID 71285804) has the molecular formula C25H21F3N2O4S and a molecular weight of 502.51 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-[2-(trifluoromethoxy)phenyl]-1H-indol-7-yl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-[2-(trifluoromethoxy)phenyl]-1H-indol-7-yl]acetamide |
|---|---|
| PubChem CID | 71285804 |
| Molecular Formula | C25H21F3N2O4S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-[2-(trifluoromethoxy)phenyl]-1H-indol-7-yl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-c3ccccc3OC(F)(F)F)c3cc[nH]c23)cc1 |
| InChI | InChI=1S/C25H21F3N2O4S/c1-2-35(32,33)17-9-7-16(8-10-17)15-23(31)30-21-12-11-18(20-13-14-29-24(20)21)19-5-3-4-6-22(19)34-25(26,27)28/h3-14,29H,2,15H2,1H3,(H,30,31) |
| InChIKey | PWJLYQQGCQHIKY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |