C24H21F3INO4S — CID 89425955
2-(4-ethylsulfonylphenyl)-N-[2-(iodomethyl)-3-[2-(trifluoromethoxy)phenyl]phenyl]acetamide (PubChem CID 89425955) has the molecular formula C24H21F3INO4S and a molecular weight of 603.40 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[2-(iodomethyl)-3-[2-(trifluoromethoxy)phenyl]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[2-(iodomethyl)-3-[2-(trifluoromethoxy)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 89425955 |
| Molecular Formula | C24H21F3INO4S |
| Molecular Weight | 603.40 g/mol |
| Exact Mass | 603.02 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[2-(iodomethyl)-3-[2-(trifluoromethoxy)phenyl]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2cccc(-c3ccccc3OC(F)(F)F)c2CI)cc1 |
| InChI | InChI=1S/C24H21F3INO4S/c1-2-34(31,32)17-12-10-16(11-13-17)14-23(30)29-21-8-5-7-18(20(21)15-28)19-6-3-4-9-22(19)33-24(25,26)27/h3-13H,2,14-15H2,1H3,(H,29,30) |
| InChIKey | JZKSROXQCAVUCR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|