C26H28ClNO4S — CID 71289987
N-[4-(2-butoxyphenyl)-3-chlorophenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 71289987) has the molecular formula C26H28ClNO4S and a molecular weight of 486.03 g/mol. Its IUPAC name is N-[4-(2-butoxyphenyl)-3-chlorophenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[4-(2-butoxyphenyl)-3-chlorophenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 71289987 |
| Molecular Formula | C26H28ClNO4S |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[4-(2-butoxyphenyl)-3-chlorophenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCCCOc1ccccc1-c1ccc(NC(=O)Cc2ccc(S(=O)(=O)CC)cc2)cc1Cl |
| InChI | InChI=1S/C26H28ClNO4S/c1-3-5-16-32-25-9-7-6-8-23(25)22-15-12-20(18-24(22)27)28-26(29)17-19-10-13-21(14-11-19)33(30,31)4-2/h6-15,18H,3-5,16-17H2,1-2H3,(H,28,29) |
| InChIKey | KMOLDMWMBJNDNF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|