C29H23Cl2NO4S — CID 71285899
N-[3-benzoyl-5-(2,4-dichlorophenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 71285899) has the molecular formula C29H23Cl2NO4S and a molecular weight of 552.48 g/mol. Its IUPAC name is N-[3-benzoyl-5-(2,4-dichlorophenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[3-benzoyl-5-(2,4-dichlorophenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 71285899 |
| Molecular Formula | C29H23Cl2NO4S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | N-[3-benzoyl-5-(2,4-dichlorophenyl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2cc(C(=O)c3ccccc3)cc(-c3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C29H23Cl2NO4S/c1-2-37(35,36)25-11-8-19(9-12-25)14-28(33)32-24-16-21(26-13-10-23(30)18-27(26)31)15-22(17-24)29(34)20-6-4-3-5-7-20/h3-13,15-18H,2,14H2,1H3,(H,32,33) |
| InChIKey | SSQBEKVWNCLIDZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |