C21H17Cl2NO3S — CID 123708136
N-(3,5-dichloro-4-phenylphenyl)-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 123708136) has the molecular formula C21H17Cl2NO3S and a molecular weight of 434.34 g/mol. Its IUPAC name is N-(3,5-dichloro-4-phenylphenyl)-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-(3,5-dichloro-4-phenylphenyl)-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 123708136 |
| Molecular Formula | C21H17Cl2NO3S |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | N-(3,5-dichloro-4-phenylphenyl)-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)Nc2cc(Cl)c(-c3ccccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H17Cl2NO3S/c1-28(26,27)17-9-7-14(8-10-17)11-20(25)24-16-12-18(22)21(19(23)13-16)15-5-3-2-4-6-15/h2-10,12-13H,11H2,1H3,(H,24,25) |
| InChIKey | ZQLMSKGEFAARFL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |