C16H14ClNO4S — CID 174982154
2-chloro-4-methylsulfonyl-N-(2-phenylacetyl)benzamide (PubChem CID 174982154) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is 2-chloro-4-methylsulfonyl-N-(2-phenylacetyl)benzamide.
| Compound Name | 2-chloro-4-methylsulfonyl-N-(2-phenylacetyl)benzamide |
|---|---|
| PubChem CID | 174982154 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-chloro-4-methylsulfonyl-N-(2-phenylacetyl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NC(=O)Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO4S/c1-23(21,22)12-7-8-13(14(17)10-12)16(20)18-15(19)9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,18,19,20) |
| InChIKey | SSEXFVBPJYBCQS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |