C14H10Cl2INO3S — CID 121004678
2-chloro-N-(4-chloro-3-iodophenyl)-4-methylsulfonylbenzamide (PubChem CID 121004678) has the molecular formula C14H10Cl2INO3S and a molecular weight of 470.12 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-iodophenyl)-4-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-iodophenyl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 121004678 |
| Molecular Formula | C14H10Cl2INO3S |
| Molecular Weight | 470.12 g/mol |
| Exact Mass | 468.88 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-iodophenyl)-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(I)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2INO3S/c1-22(20,21)9-3-4-10(12(16)7-9)14(19)18-8-2-5-11(15)13(17)6-8/h2-7H,1H3,(H,18,19) |
| InChIKey | QPNCZRBBFWIKGS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|