C22H16ClNO3S2 — CID 142392205
N-[3-(1-benzothiophen-2-yl)phenyl]-2-chloro-4-methylsulfonylbenzamide (PubChem CID 142392205) has the molecular formula C22H16ClNO3S2 and a molecular weight of 441.96 g/mol. Its IUPAC name is N-[3-(1-benzothiophen-2-yl)phenyl]-2-chloro-4-methylsulfonylbenzamide.
| Compound Name | N-[3-(1-benzothiophen-2-yl)phenyl]-2-chloro-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 142392205 |
| Molecular Formula | C22H16ClNO3S2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | N-[3-(1-benzothiophen-2-yl)phenyl]-2-chloro-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3cc4ccccc4s3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H16ClNO3S2/c1-29(26,27)17-9-10-18(19(23)13-17)22(25)24-16-7-4-6-14(11-16)21-12-15-5-2-3-8-20(15)28-21/h2-13H,1H3,(H,24,25) |
| InChIKey | ITCZIMCHEZJGGX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |