C27H24ClN3O4S — CID 141358125
2-chloro-4-methylsulfonyl-N-[3-(3-morpholin-4-ylquinolin-2-yl)phenyl]benzamide (PubChem CID 141358125) has the molecular formula C27H24ClN3O4S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-chloro-4-methylsulfonyl-N-[3-(3-morpholin-4-ylquinolin-2-yl)phenyl]benzamide.
| Compound Name | 2-chloro-4-methylsulfonyl-N-[3-(3-morpholin-4-ylquinolin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 141358125 |
| Molecular Formula | C27H24ClN3O4S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-chloro-4-methylsulfonyl-N-[3-(3-morpholin-4-ylquinolin-2-yl)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3nc4ccccc4cc3N3CCOCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C27H24ClN3O4S/c1-36(33,34)21-9-10-22(23(28)17-21)27(32)29-20-7-4-6-19(15-20)26-25(31-11-13-35-14-12-31)16-18-5-2-3-8-24(18)30-26/h2-10,15-17H,11-14H2,1H3,(H,29,32) |
| InChIKey | UBGWHJSNSUNQBH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |