C29H28ClN3O3S — CID 74763695
2-chloro-4-methylsulfonyl-N-[3-[6-(piperidin-1-ylmethyl)quinolin-2-yl]phenyl]benzamide (PubChem CID 74763695) has the molecular formula C29H28ClN3O3S and a molecular weight of 534.08 g/mol. Its IUPAC name is 2-chloro-4-methylsulfonyl-N-[3-[6-(piperidin-1-ylmethyl)quinolin-2-yl]phenyl]benzamide.
| Compound Name | 2-chloro-4-methylsulfonyl-N-[3-[6-(piperidin-1-ylmethyl)quinolin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 74763695 |
| Molecular Formula | C29H28ClN3O3S |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-chloro-4-methylsulfonyl-N-[3-[6-(piperidin-1-ylmethyl)quinolin-2-yl]phenyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3ccc4cc(CN5CCCCC5)ccc4n3)c2)c(Cl)c1 |
| InChI | InChI=1S/C29H28ClN3O3S/c1-37(35,36)24-10-11-25(26(30)18-24)29(34)31-23-7-5-6-21(17-23)28-13-9-22-16-20(8-12-27(22)32-28)19-33-14-3-2-4-15-33/h5-13,16-18H,2-4,14-15,19H2,1H3,(H,31,34) |
| InChIKey | JITVIKHSJZGLDL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |