C28H28ClN3O3S — CID 74762772
2-chloro-N-[3-[6-(diethylaminomethyl)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide (PubChem CID 74762772) has the molecular formula C28H28ClN3O3S and a molecular weight of 522.07 g/mol. Its IUPAC name is 2-chloro-N-[3-[6-(diethylaminomethyl)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[3-[6-(diethylaminomethyl)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 74762772 |
| Molecular Formula | C28H28ClN3O3S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 2-chloro-N-[3-[6-(diethylaminomethyl)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide |
| SMILES | CCN(CC)Cc1ccc2nc(-c3cccc(NC(=O)c4ccc(S(C)(=O)=O)cc4Cl)c3)ccc2c1 |
| InChI | InChI=1S/C28H28ClN3O3S/c1-4-32(5-2)18-19-9-13-26-21(15-19)10-14-27(31-26)20-7-6-8-22(16-20)30-28(33)24-12-11-23(17-25(24)29)36(3,34)35/h6-17H,4-5,18H2,1-3H3,(H,30,33) |
| InChIKey | MLTUISBOPQHWDL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |