C12H13ClN4O3S — CID 146146659
2-chloro-N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-methylsulfonylbenzamide (PubChem CID 146146659) has the molecular formula C12H13ClN4O3S and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-chloro-N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 146146659 |
| Molecular Formula | C12H13ClN4O3S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-chloro-N-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-methylsulfonylbenzamide |
| SMILES | CCc1nc(NC(=O)c2ccc(S(C)(=O)=O)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C12H13ClN4O3S/c1-3-10-14-12(17-16-10)15-11(18)8-5-4-7(6-9(8)13)21(2,19)20/h4-6H,3H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | MSWRGXHTDQHODD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |