C16H14ClN3O3S — CID 23938449
2-chloro-N-(1-methylbenzimidazol-2-yl)-4-methylsulfonylbenzamide (PubChem CID 23938449) has the molecular formula C16H14ClN3O3S and a molecular weight of 363.83 g/mol. Its IUPAC name is 2-chloro-N-(1-methylbenzimidazol-2-yl)-4-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(1-methylbenzimidazol-2-yl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 23938449 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-chloro-N-(1-methylbenzimidazol-2-yl)-4-methylsulfonylbenzamide |
| SMILES | Cn1c(NC(=O)c2ccc(S(C)(=O)=O)cc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C16H14ClN3O3S/c1-20-14-6-4-3-5-13(14)18-16(20)19-15(21)11-8-7-10(9-12(11)17)24(2,22)23/h3-9H,1-2H3,(H,18,19,21) |
| InChIKey | YDXUVMROLRTOTP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |