C15H10ClN5O5 — CID 4226202
2-chloro-N-(1-methylbenzimidazol-2-yl)-3,5-dinitrobenzamide (PubChem CID 4226202) has the molecular formula C15H10ClN5O5 and a molecular weight of 375.73 g/mol. Its IUPAC name is 2-chloro-N-(1-methylbenzimidazol-2-yl)-3,5-dinitrobenzamide.
| Compound Name | 2-chloro-N-(1-methylbenzimidazol-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4226202 |
| Molecular Formula | C15H10ClN5O5 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-chloro-N-(1-methylbenzimidazol-2-yl)-3,5-dinitrobenzamide |
| SMILES | Cn1c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2Cl)nc2ccccc21 |
| InChI | InChI=1S/C15H10ClN5O5/c1-19-11-5-3-2-4-10(11)17-15(19)18-14(22)9-6-8(20(23)24)7-12(13(9)16)21(25)26/h2-7H,1H3,(H,17,18,22) |
| InChIKey | PKTWRORCOUJWCY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|