C13H10ClN5O5 — CID 3276114
2-chloro-N-(4,6-dimethylpyrimidin-2-yl)-3,5-dinitrobenzamide (PubChem CID 3276114) has the molecular formula C13H10ClN5O5 and a molecular weight of 351.71 g/mol. Its IUPAC name is 2-chloro-N-(4,6-dimethylpyrimidin-2-yl)-3,5-dinitrobenzamide.
| Compound Name | 2-chloro-N-(4,6-dimethylpyrimidin-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3276114 |
| Molecular Formula | C13H10ClN5O5 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-chloro-N-(4,6-dimethylpyrimidin-2-yl)-3,5-dinitrobenzamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2Cl)n1 |
| InChI | InChI=1S/C13H10ClN5O5/c1-6-3-7(2)16-13(15-6)17-12(20)9-4-8(18(21)22)5-10(11(9)14)19(23)24/h3-5H,1-2H3,(H,15,16,17,20) |
| InChIKey | ZTHOXSRDDGBFLB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|