C16H14ClN3O5 — CID 4633435
2-chloro-N-(2-ethyl-6-methylphenyl)-3,5-dinitrobenzamide (PubChem CID 4633435) has the molecular formula C16H14ClN3O5 and a molecular weight of 363.76 g/mol. Its IUPAC name is 2-chloro-N-(2-ethyl-6-methylphenyl)-3,5-dinitrobenzamide.
| Compound Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4633435 |
| Molecular Formula | C16H14ClN3O5 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-3,5-dinitrobenzamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C16H14ClN3O5/c1-3-10-6-4-5-9(2)15(10)18-16(21)12-7-11(19(22)23)8-13(14(12)17)20(24)25/h4-8H,3H2,1-2H3,(H,18,21) |
| InChIKey | SXLKXDFEUUSPPH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|