C14H7ClN4O5S — CID 3512224
N-(1,3-benzothiazol-2-yl)-2-chloro-3,5-dinitrobenzamide (PubChem CID 3512224) has the molecular formula C14H7ClN4O5S and a molecular weight of 378.75 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-chloro-3,5-dinitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-chloro-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3512224 |
| Molecular Formula | C14H7ClN4O5S |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-chloro-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C14H7ClN4O5S/c15-12-8(5-7(18(21)22)6-10(12)19(23)24)13(20)17-14-16-9-3-1-2-4-11(9)25-14/h1-6H,(H,16,17,20) |
| InChIKey | LLDGBZWBDMQFOR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|