C19H19N5O8S — CID 90486469
1-(1,3-benzothiazol-2-ylamino)-3,3-dimethylbutan-2-one;2,4,6-trinitrophenol (PubChem CID 90486469) has the molecular formula C19H19N5O8S and a molecular weight of 477.46 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylamino)-3,3-dimethylbutan-2-one;2,4,6-trinitrophenol.
| Compound Name | 1-(1,3-benzothiazol-2-ylamino)-3,3-dimethylbutan-2-one;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 90486469 |
| Molecular Formula | C19H19N5O8S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylamino)-3,3-dimethylbutan-2-one;2,4,6-trinitrophenol |
| SMILES | CC(C)(C)C(=O)CNc1nc2ccccc2s1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2OS.C6H3N3O7/c1-13(2,3)11(16)8-14-12-15-9-6-4-5-7-10(9)17-12;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h4-7H,8H2,1-3H3,(H,14,15);1-2,10H |
| InChIKey | GBGVRAXNJYZKRP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 191.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|