C15H11N3O4S — CID 7793934
N-(1,3-benzothiazol-2-yl)-2-(2-nitrophenoxy)acetamide (PubChem CID 7793934) has the molecular formula C15H11N3O4S and a molecular weight of 329.34 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7793934 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H11N3O4S/c19-14(9-22-12-7-3-2-6-11(12)18(20)21)17-15-16-10-5-1-4-8-13(10)23-15/h1-8H,9H2,(H,16,17,19) |
| InChIKey | WADDAIYLRQHWOX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|