C19H13N3O6S — CID 7916665
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide (PubChem CID 7916665) has the molecular formula C19H13N3O6S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7916665 |
| Molecular Formula | C19H13N3O6S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1nc(-c2ccco2)c(-c2ccco2)s1 |
| InChI | InChI=1S/C19H13N3O6S/c23-16(11-28-13-6-2-1-5-12(13)22(24)25)20-19-21-17(14-7-3-9-26-14)18(29-19)15-8-4-10-27-15/h1-10H,11H2,(H,20,21,23) |
| InChIKey | BFEDSAFOWYEROC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|