C23H17N3O4S — CID 18279241
N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-nitrophenoxy)acetamide (PubChem CID 18279241) has the molecular formula C23H17N3O4S and a molecular weight of 431.47 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 18279241 |
| Molecular Formula | C23H17N3O4S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C23H17N3O4S/c27-20(15-30-19-13-11-18(12-14-19)26(28)29)24-23-25-21(16-7-3-1-4-8-16)22(31-23)17-9-5-2-6-10-17/h1-14H,15H2,(H,24,25,27) |
| InChIKey | VXFUUSXZTBXIBD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|