C19H17N3O4S — CID 12525792
N-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 12525792) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is N-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 12525792 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[5-methyl-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)COc3ccc([N+](=O)[O-])cc3)sc2C)cc1 |
| InChI | InChI=1S/C19H17N3O4S/c1-12-3-5-14(6-4-12)18-13(2)27-19(21-18)20-17(23)11-26-16-9-7-15(8-10-16)22(24)25/h3-10H,11H2,1-2H3,(H,20,21,23) |
| InChIKey | YSAVVPWFEZZGMJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|