C16H10F3N3O4S2 — CID 15838552
1,1,1-trifluoro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]methanesulfonamide (PubChem CID 15838552) has the molecular formula C16H10F3N3O4S2 and a molecular weight of 429.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 15838552 |
| Molecular Formula | C16H10F3N3O4S2 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 1,1,1-trifluoro-N-[5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-yl]methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(-c2sc(NS(=O)(=O)C(F)(F)F)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H10F3N3O4S2/c17-16(18,19)28(25,26)21-15-20-13(10-4-2-1-3-5-10)14(27-15)11-6-8-12(9-7-11)22(23)24/h1-9H,(H,20,21) |
| InChIKey | JFFXHRWZONPPQC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|