C22H14Cl2N4O2S — CID 94848933
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-amine (PubChem CID 94848933) has the molecular formula C22H14Cl2N4O2S and a molecular weight of 469.35 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 94848933 |
| Molecular Formula | C22H14Cl2N4O2S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(4-nitrophenyl)-4-phenyl-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2sc(N/N=C\c3ccc(Cl)cc3Cl)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H14Cl2N4O2S/c23-17-9-6-16(19(24)12-17)13-25-27-22-26-20(14-4-2-1-3-5-14)21(31-22)15-7-10-18(11-8-15)28(29)30/h1-13H,(H,26,27)/b25-13- |
| InChIKey | LSJUHKDJNOEHIP-MXAYSNPKSA-N |
| XLogP | 7.14 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|