C23H15Cl2FN4OS — CID 27315818
N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]benzamide (PubChem CID 27315818) has the molecular formula C23H15Cl2FN4OS and a molecular weight of 485.37 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]benzamide.
| Compound Name | N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 27315818 |
| Molecular Formula | C23H15Cl2FN4OS |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]benzamide |
| SMILES | O=C(Nc1sc(N/N=C\c2ccc(Cl)cc2Cl)nc1-c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H15Cl2FN4OS/c24-17-9-6-16(19(25)12-17)13-27-30-23-28-20(14-7-10-18(26)11-8-14)22(32-23)29-21(31)15-4-2-1-3-5-15/h1-13H,(H,28,30)(H,29,31)/b27-13- |
| InChIKey | XFKSWLSAYXXLRZ-WKIKZPBSSA-N |
| XLogP | 6.95 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|