C27H25FN4OS — CID 40849790
N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]-4-fluorobenzamide (PubChem CID 40849790) has the molecular formula C27H25FN4OS and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]-4-fluorobenzamide.
| Compound Name | N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 40849790 |
| Molecular Formula | C27H25FN4OS |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]-4-fluorobenzamide |
| SMILES | CC(C)(C)c1ccc(/C=N\Nc2nc(-c3ccccc3)c(NC(=O)c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C27H25FN4OS/c1-27(2,3)21-13-9-18(10-14-21)17-29-32-26-30-23(19-7-5-4-6-8-19)25(34-26)31-24(33)20-11-15-22(28)16-12-20/h4-17H,1-3H3,(H,30,32)(H,31,33)/b29-17- |
| InChIKey | ANYLQBOMGRLEGN-RHANQZHGSA-N |
| XLogP | 6.95 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|